CAS 2228387-36-6 is the registry number for 1-(3-Bromophenyl)-2,2-difluorocyclopropan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-bromophenyl)-2,2-difluorocyclopropan-1-amine (CAS 2228387-36-6) is a chemical compound with the molecular formula C9H8BrF2N and a molecular weight of 248.07 g/mol. IUPAC name: 1-(3-bromophenyl)-2,2-difluorocyclopropan-1-amine. InChIKey: OMMNMDWXQJXCJR-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF2N |
|---|---|
| Molecular weight | 248.07 g/mol |
| IUPAC name | 1-(3-bromophenyl)-2,2-difluorocyclopropan-1-amine |
| InChIKey | OMMNMDWXQJXCJR-UHFFFAOYSA-N |
| SMILES | C1C(C1(F)F)(C2=CC(=CC=C2)Br)N |
Computed by PubChem (NCBI)