Products 2821068-05-5
CAS 2821068-05-5 is the registry number for LSD1-IN-22. Offered by: MedChemExpress. Available pack sizes: Get quote.
Trans-(1R,2S)-2-(4-bromo-2,5-difluorophenyl)cyclopropan-1-amine (CAS 2821068-05-5) is a chemical compound with the molecular formula C9H8BrF2N and a molecular weight of 248.07 g/mol. IUPAC name: trans-(1R,2S)-2-(4-bromo-2,5-difluorophenyl)cyclopropan-1-amine. InChIKey: SGUWSJVKVPNXAI-SSDLBLMSSA-N.
| Molecular formula | C9H8BrF2N |
|---|---|
| Molecular weight | 248.07 g/mol |
| IUPAC name | trans-(1R,2S)-2-(4-bromo-2,5-difluorophenyl)cyclopropan-1-amine |
| InChIKey | SGUWSJVKVPNXAI-SSDLBLMSSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CC(=C(C=C2F)Br)F |
Computed by PubChem (NCBI)