CAS 1990468-00-2 is the registry number for 5-Bromo-6-(difluoromethyl)indoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-6-(difluoromethyl)-2,3-dihydro-1H-indole (CAS 1990468-00-2) is a chemical compound with the molecular formula C9H8BrF2N and a molecular weight of 248.07 g/mol. IUPAC name: 5-bromo-6-(difluoromethyl)-2,3-dihydro-1H-indole. InChIKey: ZUIUULDIIOMZDW-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF2N |
|---|---|
| Molecular weight | 248.07 g/mol |
| IUPAC name | 5-bromo-6-(difluoromethyl)-2,3-dihydro-1H-indole |
| InChIKey | ZUIUULDIIOMZDW-UHFFFAOYSA-N |
| SMILES | C1CNC2=CC(=C(C=C21)Br)C(F)F |
Computed by PubChem (NCBI)