Products 1598098-34-0
CAS 1598098-34-0 is the registry number for 5-Bromo-6,8-difluoro-1,2,3,4-tetrahydroquinoline. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-bromo-6,8-difluoro-1,2,3,4-tetrahydroquinoline (CAS 1598098-34-0) is a chemical compound with the molecular formula C9H8BrF2N and a molecular weight of 248.07 g/mol. IUPAC name: 5-bromo-6,8-difluoro-1,2,3,4-tetrahydroquinoline. InChIKey: DLVDKNQYMLWUQQ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF2N |
|---|---|
| Molecular weight | 248.07 g/mol |
| IUPAC name | 5-bromo-6,8-difluoro-1,2,3,4-tetrahydroquinoline |
| InChIKey | DLVDKNQYMLWUQQ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=CC(=C2Br)F)F)NC1 |
Computed by PubChem (NCBI)