CAS 2705927-90-6 is the registry number for 4-Acetyl-L-phenylalanine-13C6. Offered by: TRC. Available pack sizes: 25mg.
(2S)-3-(4-acetyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-2-aminopropanoic acid (CAS 2705927-90-6) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 213.18 g/mol. IUPAC name: (2S)-3-(4-acetyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-2-aminopropanoic acid. InChIKey: ZXSBHXZKWRIEIA-DFOTYUSJSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 213.18 g/mol |
| IUPAC name | (2S)-3-(4-acetyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-2-aminopropanoic acid |
| InChIKey | ZXSBHXZKWRIEIA-DFOTYUSJSA-N |
| SMILES | CC(=O)[13C]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)