CAS 2708280-48-0 is the registry number for 1-amino-4-methyl-indane-5-carboxylic acid,hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
1-amino-4-methyl-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride (CAS 2708280-48-0) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: 1-amino-4-methyl-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride. InChIKey: YUFVJDTXUGVPEC-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 1-amino-4-methyl-2,3-dihydro-1H-indene-5-carboxylic acid;hydrochloride |
| InChIKey | YUFVJDTXUGVPEC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1CCC2N)C(=O)O.Cl |
Computed by PubChem (NCBI)