Products 2708286-96-6
CAS 2708286-96-6 is the registry number for tert-Butyl (8-chloro-1,7-naphthyridin-3-yl)carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl N-(8-chloro-1,7-naphthyridin-3-yl)carbamate (CAS 2708286-96-6) is a chemical compound with the molecular formula C13H14ClN3O2 and a molecular weight of 279.72 g/mol. IUPAC name: tert-butyl N-(8-chloro-1,7-naphthyridin-3-yl)carbamate. InChIKey: NLPBXIHXAXJZKP-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN3O2 |
|---|---|
| Molecular weight | 279.72 g/mol |
| IUPAC name | tert-butyl N-(8-chloro-1,7-naphthyridin-3-yl)carbamate |
| InChIKey | NLPBXIHXAXJZKP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CN=C2C(=C1)C=CN=C2Cl |
Computed by PubChem (NCBI)