Products 2708343-64-8
CAS 2708343-64-8 appears in our catalog under these names: L-Lysine-2,3,3,4,4,5,5,6,6-d9 HCl, 99 atom % D, min 98% Chemical Purity, L–Lysine–d9 hydrochloride, L-Lysine-d9 (hydrochloride), 99%, 99%, L-Lysine-d9 (hydrochloride), 99.09%. Offered by: CDN, GLPBio, Chemat, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 10mg, 5mg, 1mg, 5 mg, 10 mg.
(2S)-2,6-diamino-2,3,3,4,4,5,5,6,6-nonadeuteriohexanoic acid;hydrochloride (CAS 2708343-64-8) is a chemical compound with the molecular formula C6H15ClN2O2 and a molecular weight of 191.70 g/mol. IUPAC name: (2S)-2,6-diamino-2,3,3,4,4,5,5,6,6-nonadeuteriohexanoic acid;hydrochloride. InChIKey: BVHLGVCQOALMSV-AIPDENHHSA-N.
| Molecular formula | C6H15ClN2O2 |
|---|---|
| Molecular weight | 191.70 g/mol |
| IUPAC name | (2S)-2,6-diamino-2,3,3,4,4,5,5,6,6-nonadeuteriohexanoic acid;hydrochloride |
| InChIKey | BVHLGVCQOALMSV-AIPDENHHSA-N |
| SMILES | [2H][C@@](C(=O)O)(C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])N)N.Cl |
Computed by PubChem (NCBI)