CAS 2709669-67-8 appears in our catalog under these names: 2-Chloro-4-isopropyl-6-nitroquinoline 97%, 2-Chloro-4-isopropyl-6-nitroquinoline, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-chloro-6-nitro-4-propan-2-ylquinoline (CAS 2709669-67-8) is a chemical compound with the molecular formula C12H11ClN2O2 and a molecular weight of 250.68 g/mol. IUPAC name: 2-chloro-6-nitro-4-propan-2-ylquinoline. InChIKey: QKNUDKYQIDLNCC-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O2 |
|---|---|
| Molecular weight | 250.68 g/mol |
| IUPAC name | 2-chloro-6-nitro-4-propan-2-ylquinoline |
| InChIKey | QKNUDKYQIDLNCC-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=NC2=C1C=C(C=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)