Products 2710626-41-6
CAS 2710626-41-6 appears in our catalog under these names: Dolutegravir Impurity 66, (R)-2-(4-Hydroxybutan-2-yl)-9-methoxy-1,8-dioxo-2,8-dihydro-1H-pyrido(1,2-a)pyrazine-7-carboxylic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
2-[(2R)-4-hydroxybutan-2-yl]-9-methoxy-1,8-dioxopyrido[1,2-a]pyrazine-7-carboxylic acid (CAS 2710626-41-6) is a chemical compound with the molecular formula C14H16N2O6 and a molecular weight of 308.29 g/mol. IUPAC name: 2-[(2R)-4-hydroxybutan-2-yl]-9-methoxy-1,8-dioxopyrido[1,2-a]pyrazine-7-carboxylic acid. InChIKey: XRQILRQQCXIUEI-MRVPVSSYSA-N.
| Molecular formula | C14H16N2O6 |
|---|---|
| Molecular weight | 308.29 g/mol |
| IUPAC name | 2-[(2R)-4-hydroxybutan-2-yl]-9-methoxy-1,8-dioxopyrido[1,2-a]pyrazine-7-carboxylic acid |
| InChIKey | XRQILRQQCXIUEI-MRVPVSSYSA-N |
| SMILES | C[C@H](CCO)N1C=CN2C=C(C(=O)C(=C2C1=O)OC)C(=O)O |
Computed by PubChem (NCBI)