CAS 7255-58-5 appears in our catalog under these names: Diethyl 2-((2-nitrophenylamino)methylene)malonate, 95%, Diethyl 2–((2–nitrophenylamino)methylene)malonate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Diethyl 2-[(2-nitroanilino)methylidene]propanedioate (CAS 7255-58-5) is a chemical compound with the molecular formula C14H16N2O6 and a molecular weight of 308.29 g/mol. IUPAC name: diethyl 2-[(2-nitroanilino)methylidene]propanedioate. InChIKey: JTGABQDBMSKAOX-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O6 |
|---|---|
| Molecular weight | 308.29 g/mol |
| IUPAC name | diethyl 2-[(2-nitroanilino)methylidene]propanedioate |
| InChIKey | JTGABQDBMSKAOX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=CNC1=CC=CC=C1[N+](=O)[O-])C(=O)OCC |
Computed by PubChem (NCBI)