CAS 60474-41-1 is the registry number for 4-Acetamidobenzoyl)glutamic Acid. Offered by: TRC. Available pack sizes: 500mg.
(2S)-2-[(4-acetamidobenzoyl)amino]pentanedioic acid (CAS 60474-41-1) is a chemical compound with the molecular formula C14H16N2O6 and a molecular weight of 308.29 g/mol. IUPAC name: (2S)-2-[(4-acetamidobenzoyl)amino]pentanedioic acid. InChIKey: MGJNINDWRXYHBA-NSHDSACASA-N.
| Molecular formula | C14H16N2O6 |
|---|---|
| Molecular weight | 308.29 g/mol |
| IUPAC name | (2S)-2-[(4-acetamidobenzoyl)amino]pentanedioic acid |
| InChIKey | MGJNINDWRXYHBA-NSHDSACASA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)