CAS 2315439-81-5 is the registry number for Dolutegravir Impurity 67. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,7R)-11-methoxy-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxylic acid (CAS 2315439-81-5) is a chemical compound with the molecular formula C14H16N2O6 and a molecular weight of 308.29 g/mol. IUPAC name: (3R,7R)-11-methoxy-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxylic acid. InChIKey: KGWJKKUSXSBPSK-VXNVDRBHSA-N.
| Molecular formula | C14H16N2O6 |
|---|---|
| Molecular weight | 308.29 g/mol |
| IUPAC name | (3R,7R)-11-methoxy-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxylic acid |
| InChIKey | KGWJKKUSXSBPSK-VXNVDRBHSA-N |
| SMILES | C[C@@H]1CCO[C@H]2N1C(=O)C3=C(C(=O)C(=CN3C2)C(=O)O)OC |
Computed by PubChem (NCBI)