Products 1220967-83-8
CAS 1220967-83-8 is the registry number for (4-Acetamidobenzoyl)-L-glutamic-13C5 Acid. Offered by: TRC. Available pack sizes: 50mg.
(2S)-2-[(4-acetamidobenzoyl)amino](1,2,3,4,5-13C5)pentanedioic acid (CAS 1220967-83-8) is a chemical compound with the molecular formula C14H16N2O6 and a molecular weight of 313.25 g/mol. IUPAC name: (2S)-2-[(4-acetamidobenzoyl)amino](1,2,3,4,5-13C5)pentanedioic acid. InChIKey: MGJNINDWRXYHBA-AJZXBWRGSA-N.
| Molecular formula | C14H16N2O6 |
|---|---|
| Molecular weight | 313.25 g/mol |
| IUPAC name | (2S)-2-[(4-acetamidobenzoyl)amino](1,2,3,4,5-13C5)pentanedioic acid |
| InChIKey | MGJNINDWRXYHBA-AJZXBWRGSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)C(=O)N[13C@@H]([13CH2][13CH2][13C](=O)O)[13C](=O)O |
Computed by PubChem (NCBI)