CAS 40107-10-6 is the registry number for Diethyl (3-nitrophenylaminomethylene)malonate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g.
Diethyl 2-[(3-nitroanilino)methylidene]propanedioate (CAS 40107-10-6) is a chemical compound with the molecular formula C14H16N2O6 and a molecular weight of 308.29 g/mol. IUPAC name: diethyl 2-[(3-nitroanilino)methylidene]propanedioate. InChIKey: VNKXJOYRWHAQGB-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O6 |
|---|---|
| Molecular weight | 308.29 g/mol |
| IUPAC name | diethyl 2-[(3-nitroanilino)methylidene]propanedioate |
| InChIKey | VNKXJOYRWHAQGB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=CNC1=CC(=CC=C1)[N+](=O)[O-])C(=O)OCC |
Computed by PubChem (NCBI)