Products 2711425-40-8
CAS 2711425-40-8 is the registry number for (3-chloro-2,6-dimethoxyphenyl)(methyl)sulfane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-chloro-2,4-dimethoxy-3-methylsulfanylbenzene (CAS 2711425-40-8) is a chemical compound with the molecular formula C9H11ClO2S and a molecular weight of 218.70 g/mol. IUPAC name: 1-chloro-2,4-dimethoxy-3-methylsulfanylbenzene. InChIKey: MRSMGUNMFCEXFL-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO2S |
|---|---|
| Molecular weight | 218.70 g/mol |
| IUPAC name | 1-chloro-2,4-dimethoxy-3-methylsulfanylbenzene |
| InChIKey | MRSMGUNMFCEXFL-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Cl)OC)SC |
Computed by PubChem (NCBI)