Products 2714483-61-9
CAS 2714483-61-9 is the registry number for rac-Amphetamine-D10 Hydrochloride 0.1 mg/ml in Methanol (as free base). Offered by: LoGiCal. Available pack sizes: 1ml.
1,1,1,2,3-pentadeuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propan-2-amine;hydrochloride (CAS 2714483-61-9) is a chemical compound with the molecular formula C9H14ClN and a molecular weight of 181.73 g/mol. IUPAC name: 1,1,1,2,3-pentadeuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propan-2-amine;hydrochloride. InChIKey: SEVKYLYIYIKRSW-ZFJIXVKLSA-N.
| Molecular formula | C9H14ClN |
|---|---|
| Molecular weight | 181.73 g/mol |
| IUPAC name | 1,1,1,2,3-pentadeuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propan-2-amine;hydrochloride |
| InChIKey | SEVKYLYIYIKRSW-ZFJIXVKLSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])C([2H])(C([2H])([2H])[2H])N)[2H])[2H].Cl |
Computed by PubChem (NCBI)