CAS 2714486-16-3 is the registry number for trans-Permethrinic acid D6 (dimethyl D6) 100 µg/mL in Acetone. Offered by: Dr. Ehrenstorfer. Available pack sizes: 1ml.
Cis-(1R,3S)-3-(2,2-dichloroethenyl)-2,2-bis(trideuteriomethyl)cyclopropane-1-carboxylic acid (CAS 2714486-16-3) is a chemical compound with the molecular formula C8H10Cl2O2 and a molecular weight of 215.10 g/mol. IUPAC name: cis-(1R,3S)-3-(2,2-dichloroethenyl)-2,2-bis(trideuteriomethyl)cyclopropane-1-carboxylic acid. InChIKey: LLMLSUSAKZVFOA-FNRKSKESSA-N.
| Molecular formula | C8H10Cl2O2 |
|---|---|
| Molecular weight | 215.10 g/mol |
| IUPAC name | cis-(1R,3S)-3-(2,2-dichloroethenyl)-2,2-bis(trideuteriomethyl)cyclopropane-1-carboxylic acid |
| InChIKey | LLMLSUSAKZVFOA-FNRKSKESSA-N |
| SMILES | [2H]C([2H])([2H])C1([C@@H]([C@H]1C(=O)O)C=C(Cl)Cl)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)