CAS 59042-50-1 appears in our catalog under these names: trans-Permethric acid , rac-trans-Permethrinic Acid, trans-Permethrinic acid, trans-Permethrinic acid 100 µg/mL in Acetonitrile. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer. Available pack sizes: on request, 100mg, 2,5g, 250mg, 25mg, 1ml.
Cis-(1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid (CAS 59042-50-1) is a chemical compound with the molecular formula C8H10Cl2O2 and a molecular weight of 209.07 g/mol. IUPAC name: cis-(1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid. InChIKey: LLMLSUSAKZVFOA-XINAWCOVSA-N.
| Molecular formula | C8H10Cl2O2 |
|---|---|
| Molecular weight | 209.07 g/mol |
| IUPAC name | cis-(1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
| InChIKey | LLMLSUSAKZVFOA-XINAWCOVSA-N |
| SMILES | CC1([C@@H]([C@H]1C(=O)O)C=C(Cl)Cl)C |
Computed by PubChem (NCBI)