CAS 55667-40-8 appears in our catalog under these names: (+)-cis-Permethrinic Acid, >95% (HPLC), (+)-cis-Permethrinic acid, (+)-cis-Permethrinic Acid, 95%, 95%, (+)-cis-Permethrinic acid, 100 mg, (+)-cis-Permethrinic acid, 250 mg. Offered by: TRC, Biosynth, Chemat, Roth. Available pack sizes: 100mg, 1g, 500mg, 0,25g, 0,1g, 0,5g, 250mg.
Trans-(1R,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid (CAS 55667-40-8) is a chemical compound with the molecular formula C8H10Cl2O2 and a molecular weight of 209.07 g/mol. IUPAC name: trans-(1R,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid. InChIKey: LLMLSUSAKZVFOA-NJGYIYPDSA-N.
| Molecular formula | C8H10Cl2O2 |
|---|---|
| Molecular weight | 209.07 g/mol |
| IUPAC name | trans-(1R,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
| InChIKey | LLMLSUSAKZVFOA-NJGYIYPDSA-N |
| SMILES | CC1([C@H]([C@H]1C(=O)O)C=C(Cl)Cl)C |
Computed by PubChem (NCBI)