CAS 55701-03-6 appears in our catalog under these names: Permethrin Impurity 2, 1R-trans-Permethrinic Acid, (1R,3S)-3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid, 98%, 98%, trans-3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropane-1-carboxylic acid, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, Chemat, HPC Standards. Available pack sizes: on request, 10g, 1g, 5g, 1x1ml.
Cis-(1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid (CAS 55701-03-6) is a chemical compound with the molecular formula C8H10Cl2O2 and a molecular weight of 209.07 g/mol. IUPAC name: cis-(1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid. InChIKey: LLMLSUSAKZVFOA-XINAWCOVSA-N.
| Molecular formula | C8H10Cl2O2 |
|---|---|
| Molecular weight | 209.07 g/mol |
| IUPAC name | cis-(1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
| InChIKey | LLMLSUSAKZVFOA-XINAWCOVSA-N |
| SMILES | CC1([C@@H]([C@H]1C(=O)O)C=C(Cl)Cl)C |
Computed by PubChem (NCBI)