CAS 55701-08-1 is the registry number for (1S,3S)-3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropane-1-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Trans-(1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid (CAS 55701-08-1) is a chemical compound with the molecular formula C8H10Cl2O2 and a molecular weight of 209.07 g/mol. IUPAC name: trans-(1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid. InChIKey: LLMLSUSAKZVFOA-INEUFUBQSA-N.
| Molecular formula | C8H10Cl2O2 |
|---|---|
| Molecular weight | 209.07 g/mol |
| IUPAC name | trans-(1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
| InChIKey | LLMLSUSAKZVFOA-INEUFUBQSA-N |
| SMILES | CC1([C@@H]([C@@H]1C(=O)O)C=C(Cl)Cl)C |
Computed by PubChem (NCBI)