CAS 27147-69-9 appears in our catalog under these names: Dapsone Impurity 5, Dapsone Impurity 19, Dapsone Impurity 8, 2,4'-Diaminophenyl Sulfone, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 500mg.
2-(4-aminophenyl)sulfonylaniline (CAS 27147-69-9) is a chemical compound with the molecular formula C12H12N2O2S and a molecular weight of 248.30 g/mol. IUPAC name: 2-(4-aminophenyl)sulfonylaniline. InChIKey: BYVOGVXITRNMSF-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2S |
|---|---|
| Molecular weight | 248.30 g/mol |
| IUPAC name | 2-(4-aminophenyl)sulfonylaniline |
| InChIKey | BYVOGVXITRNMSF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)S(=O)(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)