CAS 2720590-02-1 is the registry number for 6-Fluoro-7-hydroxy-8-methylchroman-4-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-fluoro-7-hydroxy-8-methyl-2,3-dihydrochromen-4-one (CAS 2720590-02-1) is a chemical compound with the molecular formula C10H9FO3 and a molecular weight of 196.17 g/mol. IUPAC name: 6-fluoro-7-hydroxy-8-methyl-2,3-dihydrochromen-4-one. InChIKey: ULFXKGOXQDAVPW-UHFFFAOYSA-N.
| Molecular formula | C10H9FO3 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | 6-fluoro-7-hydroxy-8-methyl-2,3-dihydrochromen-4-one |
| InChIKey | ULFXKGOXQDAVPW-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC(=C1O)F)C(=O)CCO2 |
Computed by PubChem (NCBI)