Products 2721373-88-0
CAS 2721373-88-0 is the registry number for Ethyl 3-formyl-8-methoxyquinoline-6-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-formyl-8-methoxyquinoline-6-carboxylate (CAS 2721373-88-0) is a chemical compound with the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. IUPAC name: ethyl 3-formyl-8-methoxyquinoline-6-carboxylate. InChIKey: ACLWJAGIXFKRDQ-UHFFFAOYSA-N.
| Molecular formula | C14H13NO4 |
|---|---|
| Molecular weight | 259.26 g/mol |
| IUPAC name | ethyl 3-formyl-8-methoxyquinoline-6-carboxylate |
| InChIKey | ACLWJAGIXFKRDQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C2C(=C1)C=C(C=N2)C=O)OC |
Computed by PubChem (NCBI)