Products 404905-33-5
CAS 404905-33-5 is the registry number for 1-(3-acetylphenyl)-3-((4-methylphenyl)sulfonyl)urea. Offered by: Biosynth. Available pack sizes: 250mg.
1-(3-acetylphenyl)-3-(4-methylphenyl)sulfonylurea (CAS 404905-33-5) is a chemical compound with the molecular formula C16H16N2O4S and a molecular weight of 332.4 g/mol. IUPAC name: 1-(3-acetylphenyl)-3-(4-methylphenyl)sulfonylurea. InChIKey: HQGBVGWNOXPYBO-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O4S |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 1-(3-acetylphenyl)-3-(4-methylphenyl)sulfonylurea |
| InChIKey | HQGBVGWNOXPYBO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(=O)NC2=CC=CC(=C2)C(=O)C |
Computed by PubChem (NCBI)