Products 781656-66-4
CAS 781656-66-4 appears in our catalog under these names: PKM2 activator 4, PKM2 activator 4, ≥97%, WAY–331603. Offered by: MedChemExpress, Chemat, GLPBio. Available pack sizes: 5 mg, 10 mg, 50 mg, 1 mg, 25 mg, 5mg, 10mg, 25mg.
N-benzyl-N,3-dimethyl-2-oxo-1,3-benzoxazole-6-sulfonamide (CAS 781656-66-4) is a chemical compound with the molecular formula C16H16N2O4S and a molecular weight of 332.4 g/mol. IUPAC name: N-benzyl-N,3-dimethyl-2-oxo-1,3-benzoxazole-6-sulfonamide. InChIKey: YQAHCTSIMVHYRE-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O4S |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | N-benzyl-N,3-dimethyl-2-oxo-1,3-benzoxazole-6-sulfonamide |
| InChIKey | YQAHCTSIMVHYRE-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)S(=O)(=O)N(C)CC3=CC=CC=C3)OC1=O |
Computed by PubChem (NCBI)