CAS 2732-18-5 appears in our catalog under these names: 5,7–Dihydroxycoumarin, 5,7-Dihydroxycoumarin/ 97.39% (existing batch purity), 5,7-Dihydroxycoumarin 98%, 5,7-Dihydroxy-2H-chromen-2-one, 97%, 97%, 5,7-Dihydroxycoumarin, 99.47%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 500mg, 200mg, 100mg, 250mg, 1g, 5g, 25g, 1 g.
5,7-dihydroxychromen-2-one (CAS 2732-18-5) is a chemical compound with the molecular formula C9H6O4 and a molecular weight of 178.14 g/mol. IUPAC name: 5,7-dihydroxychromen-2-one. InChIKey: KIQQFVJHWNCGAU-UHFFFAOYSA-N.
| Molecular formula | C9H6O4 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 5,7-dihydroxychromen-2-one |
| InChIKey | KIQQFVJHWNCGAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)OC2=CC(=CC(=C21)O)O |
Computed by PubChem (NCBI)