Products 2733160-00-2
CAS 2733160-00-2 appears in our catalog under these names: Monoisopropyl Phthalate-d4, >95% (HPLC), mono-iso-Propyl Phthalate-3,4,5,6-d4, 99 atom % D, min 98% Chemical Purity, Mono-iso-Propyl Phthalate-3,4,5,6-d4. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 100mg, 10mg, 0,1g, 0,05g, 1 mg, 5 mg.
2,3,4,5-tetradeuterio-6-propan-2-yloxycarbonylbenzoic acid (CAS 2733160-00-2) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 212.23 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-propan-2-yloxycarbonylbenzoic acid. InChIKey: CXJOEMLCEGZVPL-LNFUJOGGSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 212.23 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-propan-2-yloxycarbonylbenzoic acid |
| InChIKey | CXJOEMLCEGZVPL-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)C(=O)OC(C)C)[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
Monoisopropyl Phthalate-d4