Products 2734774-18-4
CAS 2734774-18-4 is the registry number for 3,4-difluoro-N,2-dimethoxy-N-methylbenzamide, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
3,4-difluoro-N,2-dimethoxy-N-methylbenzamide (CAS 2734774-18-4) is a chemical compound with the molecular formula C10H11F2NO3 and a molecular weight of 231.20 g/mol. IUPAC name: 3,4-difluoro-N,2-dimethoxy-N-methylbenzamide. InChIKey: VBAXXPBMFNTTSW-UHFFFAOYSA-N.
| Molecular formula | C10H11F2NO3 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | 3,4-difluoro-N,2-dimethoxy-N-methylbenzamide |
| InChIKey | VBAXXPBMFNTTSW-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=C(C(=C(C=C1)F)F)OC)OC |
Computed by PubChem (NCBI)