CAS 2738495-00-4 is the registry number for 5,7-Dichloro-2,3-dimethyl-1,8-naphthyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-dichloro-2,3-dimethyl-1,8-naphthyridine (CAS 2738495-00-4) is a chemical compound with the molecular formula C10H8Cl2N2 and a molecular weight of 227.09 g/mol. IUPAC name: 5,7-dichloro-2,3-dimethyl-1,8-naphthyridine. InChIKey: DJBBQBCVNJQDPQ-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N2 |
|---|---|
| Molecular weight | 227.09 g/mol |
| IUPAC name | 5,7-dichloro-2,3-dimethyl-1,8-naphthyridine |
| InChIKey | DJBBQBCVNJQDPQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N=C1C)N=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)