CAS 2739770-60-4 is the registry number for (S)-6,7-Dihydro-5H-cyclopenta[b]pyridin-7-amine dihydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(7S)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine;dihydrochloride (CAS 2739770-60-4) is a chemical compound with the molecular formula C8H12Cl2N2 and a molecular weight of 207.10 g/mol. IUPAC name: (7S)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine;dihydrochloride. InChIKey: GGQNZTGPGCJQKU-KLXURFKVSA-N.
| Molecular formula | C8H12Cl2N2 |
|---|---|
| Molecular weight | 207.10 g/mol |
| IUPAC name | (7S)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine;dihydrochloride |
| InChIKey | GGQNZTGPGCJQKU-KLXURFKVSA-N |
| SMILES | C1CC2=C([C@H]1N)N=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)