CAS 1932614-56-6 appears in our catalog under these names: 6,7-Dihydro-5H-(1)pyrindin-7-ylamine dihydrochloride, 6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine dihydrochloride, 98%, 98%, 6,7-Dihydro-5H-[1]pyrindin-7-ylamine dihydrochloride, 97%, 6,7-Dihydro-5H-cyclopenta[b]pyridin-7-amine dihydrochloride, 98%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 5g.
6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine;dihydrochloride (CAS 1932614-56-6) is a chemical compound with the molecular formula C8H12Cl2N2 and a molecular weight of 207.10 g/mol. IUPAC name: 6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine;dihydrochloride. InChIKey: GGQNZTGPGCJQKU-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N2 |
|---|---|
| Molecular weight | 207.10 g/mol |
| IUPAC name | 6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine;dihydrochloride |
| InChIKey | GGQNZTGPGCJQKU-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1N)N=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)