CAS 27402-47-7 appears in our catalog under these names: 5–Benzylidenebarbituric Acid, 5-Benzylidenebarbituric Acid, >98.0%(T), 5-Benzylidenepyrimidine-2,4,6(1H,3H,5H)-trione, 98%, 98%, 5-(Phenylmethylidene)-1,3-diazinane-2,4,6-trione, 98%,RG. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g.
5-benzylidene-1,3-diazinane-2,4,6-trione (CAS 27402-47-7) is a chemical compound with the molecular formula C11H8N2O3 and a molecular weight of 216.19 g/mol. IUPAC name: 5-benzylidene-1,3-diazinane-2,4,6-trione. InChIKey: CMWDWOZYVQQAMI-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O3 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | 5-benzylidene-1,3-diazinane-2,4,6-trione |
| InChIKey | CMWDWOZYVQQAMI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C=C2C(=O)NC(=O)NC2=O |
Computed by PubChem (NCBI)