Products 2743442-67-1
CAS 2743442-67-1 is the registry number for 1,5,6,7,8,9-Hexahydro-2H-5,8-epiminocyclohepta[b]pyridin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3-dien-5-one (CAS 2743442-67-1) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: 6,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3-dien-5-one. InChIKey: XGUUAYUKBBQNAA-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 6,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3-dien-5-one |
| InChIKey | XGUUAYUKBBQNAA-UHFFFAOYSA-N |
| SMILES | C1CC2C3=C(CC1N2)NC(=O)C=C3 |
Computed by PubChem (NCBI)