CAS 27473-62-7 appears in our catalog under these names: 2-Amino-2-indancarboxylic acid, 95%, 2-Aminoindan-2-carboxylic Acid, 2–Aminoindan–2–carboxylic Acid, 2-Aminoindane-2-carboxylic acid, H-Aic-OH 97%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 50mg, 5g, 500mg.
2-amino-1,3-dihydroindene-2-carboxylic acid (CAS 27473-62-7) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 2-amino-1,3-dihydroindene-2-carboxylic acid. InChIKey: UHQFXIWMAQOCAN-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 2-amino-1,3-dihydroindene-2-carboxylic acid |
| InChIKey | UHQFXIWMAQOCAN-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2CC1(C(=O)O)N |
Computed by PubChem (NCBI)