Products 2747918-57-4
CAS 2747918-57-4 appears in our catalog under these names: Mevalonic acid–13C,d3 sodium, Mevalonic acid-13C,d3 (sodium), 99%, 99%, Mevalonic acid-13C,d3 (sodium), 99.0%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 1 mg.
Sodium 3,5-dihydroxy-3-(trideuterio(113C)methyl)pentanoate (CAS 2747918-57-4) is a chemical compound with the molecular formula C6H11NaO4 and a molecular weight of 174.15 g/mol. IUPAC name: sodium 3,5-dihydroxy-3-(trideuterio(113C)methyl)pentanoate. InChIKey: RIYNLCMADQUBEM-SPZGMPHYSA-M.
| Molecular formula | C6H11NaO4 |
|---|---|
| Molecular weight | 174.15 g/mol |
| IUPAC name | sodium 3,5-dihydroxy-3-(trideuterio(113C)methyl)pentanoate |
| InChIKey | RIYNLCMADQUBEM-SPZGMPHYSA-M |
| SMILES | [2H][13C]([2H])([2H])C(CCO)(CC(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)