Products 332360-07-3
CAS 332360-07-3 is the registry number for 4–Methyl–2–oxopentanoic acid sodium salt hydrate. Offered by: GLPBio. Available pack sizes: 1g, 5g.
Sodium;4-methyl-2-oxopentanoate;hydrate (CAS 332360-07-3) is a chemical compound with the molecular formula C6H11NaO4 and a molecular weight of 170.14 g/mol. IUPAC name: sodium;4-methyl-2-oxopentanoate;hydrate. InChIKey: FUDIEMDWYRETTC-UHFFFAOYSA-M.
| Molecular formula | C6H11NaO4 |
|---|---|
| Molecular weight | 170.14 g/mol |
| IUPAC name | sodium;4-methyl-2-oxopentanoate;hydrate |
| InChIKey | FUDIEMDWYRETTC-UHFFFAOYSA-M |
| SMILES | CC(C)CC(=O)C(=O)[O-].O.[Na+] |
Computed by PubChem (NCBI)
Synonyms:
Sodium 4-methyl-2-oxopentanoate hydrate, 4-Methyl-2-oxopentanoic acid sodium salt hydrate, sodium;4-methyl-2-oxopentanoate;hydrate, 4-Methyl-2-oxovaleric Acid Sodium Salt Monohydrate, Sodium4-methyl-2-oxopentanoatehydrate, Sodium 4-methyl-2-oxopentanoate xhydrate, sodium;4-methyl-2-oxo-pentanoate;hydrate, 4-Methyl-2-oxopentanoic acid sodium salt hydrate, >=98%