Products 2752903-99-2
CAS 2752903-99-2 is the registry number for 5-methoxypyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
5-methoxypyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid (CAS 2752903-99-2) is a chemical compound with the molecular formula C10H8N2O5 and a molecular weight of 236.18 g/mol. IUPAC name: 5-methoxypyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid. InChIKey: PWKLQDLYXCLYHZ-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O5 |
|---|---|
| Molecular weight | 236.18 g/mol |
| IUPAC name | 5-methoxypyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid |
| InChIKey | PWKLQDLYXCLYHZ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=NN2C=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)