CAS 2753-74-4 is the registry number for 5-Phenyl-5-ethyl-2-thiobarbituric Acid. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
5-ethyl-5-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione (CAS 2753-74-4) is a chemical compound with the molecular formula C12H12N2O2S and a molecular weight of 248.30 g/mol. IUPAC name: 5-ethyl-5-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione. InChIKey: GHHFRPRCYQNNDL-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2S |
|---|---|
| Molecular weight | 248.30 g/mol |
| IUPAC name | 5-ethyl-5-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| InChIKey | GHHFRPRCYQNNDL-UHFFFAOYSA-N |
| SMILES | CCC1(C(=O)NC(=S)NC1=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)