Products 73738-04-2
CAS 73738-04-2 is the registry number for 5-Phenyl-5-ethyl-2-thiobarbituric Acid-d5. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
5-(1,1,2,2,2-pentadeuterioethyl)-5-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione (CAS 73738-04-2) is a chemical compound with the molecular formula C12H12N2O2S and a molecular weight of 253.33 g/mol. IUPAC name: 5-(1,1,2,2,2-pentadeuterioethyl)-5-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione. InChIKey: GHHFRPRCYQNNDL-ZBJDZAJPSA-N.
| Molecular formula | C12H12N2O2S |
|---|---|
| Molecular weight | 253.33 g/mol |
| IUPAC name | 5-(1,1,2,2,2-pentadeuterioethyl)-5-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| InChIKey | GHHFRPRCYQNNDL-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1(C(=O)NC(=S)NC1=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)