CAS 2756334-36-6 is the registry number for 2-Ethyl-5-fluoro-3-oxo-3,4-dihydroquinoxaline-6-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-ethyl-5-fluoro-3-oxo-4H-quinoxaline-6-carbaldehyde (CAS 2756334-36-6) is a chemical compound with the molecular formula C11H9FN2O2 and a molecular weight of 220.20 g/mol. IUPAC name: 2-ethyl-5-fluoro-3-oxo-4H-quinoxaline-6-carbaldehyde. InChIKey: BBZHHMZSEIKWBY-UHFFFAOYSA-N.
| Molecular formula | C11H9FN2O2 |
|---|---|
| Molecular weight | 220.20 g/mol |
| IUPAC name | 2-ethyl-5-fluoro-3-oxo-4H-quinoxaline-6-carbaldehyde |
| InChIKey | BBZHHMZSEIKWBY-UHFFFAOYSA-N |
| SMILES | CCC1=NC2=C(C(=C(C=C2)C=O)F)NC1=O |
Computed by PubChem (NCBI)