CAS 2757096-66-3 is the registry number for 2-Fluoro-5-nitronaphthalen-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluoro-5-nitronaphthalen-1-amine (CAS 2757096-66-3) is a chemical compound with the molecular formula C10H7FN2O2 and a molecular weight of 206.17 g/mol. IUPAC name: 2-fluoro-5-nitronaphthalen-1-amine. InChIKey: UQWBNSODZWJSLF-UHFFFAOYSA-N.
| Molecular formula | C10H7FN2O2 |
|---|---|
| Molecular weight | 206.17 g/mol |
| IUPAC name | 2-fluoro-5-nitronaphthalen-1-amine |
| InChIKey | UQWBNSODZWJSLF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N)F)C(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)