CAS 2758005-15-9 appears in our catalog under these names: Irbesartan Impurity 23, 4'-(Azidomethyl)-(1,1'-biphenyl)-2-carboxylic Acid, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg, 50mg.
2-[4-(azidomethyl)phenyl]benzoic acid (CAS 2758005-15-9) is a chemical compound with the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. IUPAC name: 2-[4-(azidomethyl)phenyl]benzoic acid. InChIKey: YZZMRXRBOGEUQD-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O2 |
|---|---|
| Molecular weight | 253.26 g/mol |
| IUPAC name | 2-[4-(azidomethyl)phenyl]benzoic acid |
| InChIKey | YZZMRXRBOGEUQD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)CN=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)