Products 2761593-40-0
CAS 2761593-40-0 is the registry number for 4-Methyl-N’-(2,2,2-trifluoroethyl)benzenesulfonohydrazide, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-methyl-N'-(2,2,2-trifluoroethyl)benzenesulfonohydrazide (CAS 2761593-40-0) is a chemical compound with the molecular formula C9H11F3N2O2S and a molecular weight of 268.26 g/mol. IUPAC name: 4-methyl-N'-(2,2,2-trifluoroethyl)benzenesulfonohydrazide. InChIKey: OLKFBPDLYSLPEN-UHFFFAOYSA-N.
| Molecular formula | C9H11F3N2O2S |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | 4-methyl-N'-(2,2,2-trifluoroethyl)benzenesulfonohydrazide |
| InChIKey | OLKFBPDLYSLPEN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NNCC(F)(F)F |
Computed by PubChem (NCBI)