CAS 2764729-69-1 is the registry number for 1-(3-(Benzyloxy)-2,4-difluorophenyl)ethanone, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-(2,4-difluoro-3-phenylmethoxyphenyl)ethanone (CAS 2764729-69-1) is a chemical compound with the molecular formula C15H12F2O2 and a molecular weight of 262.25 g/mol. IUPAC name: 1-(2,4-difluoro-3-phenylmethoxyphenyl)ethanone. InChIKey: KPJNSUPHMZJQMY-UHFFFAOYSA-N.
| Molecular formula | C15H12F2O2 |
|---|---|
| Molecular weight | 262.25 g/mol |
| IUPAC name | 1-(2,4-difluoro-3-phenylmethoxyphenyl)ethanone |
| InChIKey | KPJNSUPHMZJQMY-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=C(C=C1)F)OCC2=CC=CC=C2)F |
Computed by PubChem (NCBI)