CAS 2764732-06-9 is the registry number for 4-(Benzyloxy)-2,5-dichlorobenzoic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2,5-dichloro-4-phenylmethoxybenzoic acid (CAS 2764732-06-9) is a chemical compound with the molecular formula C14H10Cl2O3 and a molecular weight of 297.1 g/mol. IUPAC name: 2,5-dichloro-4-phenylmethoxybenzoic acid. InChIKey: IVCRSDZRMQZRRP-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2O3 |
|---|---|
| Molecular weight | 297.1 g/mol |
| IUPAC name | 2,5-dichloro-4-phenylmethoxybenzoic acid |
| InChIKey | IVCRSDZRMQZRRP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C(=C2)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)