CAS 2765076-71-7 is the registry number for Methyl 7-bromo-3-oxoisoindoline-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 7-bromo-3-oxo-1,2-dihydroisoindole-5-carboxylate (CAS 2765076-71-7) is a chemical compound with the molecular formula C10H8BrNO3 and a molecular weight of 270.08 g/mol. IUPAC name: methyl 7-bromo-3-oxo-1,2-dihydroisoindole-5-carboxylate. InChIKey: CPLQTBBVZFQNBK-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO3 |
|---|---|
| Molecular weight | 270.08 g/mol |
| IUPAC name | methyl 7-bromo-3-oxo-1,2-dihydroisoindole-5-carboxylate |
| InChIKey | CPLQTBBVZFQNBK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(CNC2=O)C(=C1)Br |
Computed by PubChem (NCBI)