Products 2767124-77-4
CAS 2767124-77-4 appears in our catalog under these names: (R)-STU104/ 98.91% (existing batch purity), (R)–STU104, (R)-STU104 95%, (R)-STU104, 98%, 98%, (R)-STU104, 99.91%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 25 mg.
(3R)-4,6-dimethoxy-3-(4-methoxyphenyl)-2,3-dihydroinden-1-one (CAS 2767124-77-4) is a chemical compound with the molecular formula C18H18O4 and a molecular weight of 298.3 g/mol. IUPAC name: (3R)-4,6-dimethoxy-3-(4-methoxyphenyl)-2,3-dihydroinden-1-one. InChIKey: OYJBHGSSAJNKJF-CQSZACIVSA-N.
| Molecular formula | C18H18O4 |
|---|---|
| Molecular weight | 298.3 g/mol |
| IUPAC name | (3R)-4,6-dimethoxy-3-(4-methoxyphenyl)-2,3-dihydroinden-1-one |
| InChIKey | OYJBHGSSAJNKJF-CQSZACIVSA-N |
| SMILES | COC1=CC=C(C=C1)[C@H]2CC(=O)C3=C2C(=CC(=C3)OC)OC |
Computed by PubChem (NCBI)