Products 2767446-32-0
CAS 2767446-32-0 is the registry number for Tubulin inhibitor 16. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-fluoro-3-(3-methoxyphenyl)-2H-isoquinolin-1-one (CAS 2767446-32-0) is a chemical compound with the molecular formula C16H12FNO2 and a molecular weight of 269.27 g/mol. IUPAC name: 6-fluoro-3-(3-methoxyphenyl)-2H-isoquinolin-1-one. InChIKey: HZIKMGXAFFAFJD-UHFFFAOYSA-N.
| Molecular formula | C16H12FNO2 |
|---|---|
| Molecular weight | 269.27 g/mol |
| IUPAC name | 6-fluoro-3-(3-methoxyphenyl)-2H-isoquinolin-1-one |
| InChIKey | HZIKMGXAFFAFJD-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CC3=C(C=CC(=C3)F)C(=O)N2 |
Computed by PubChem (NCBI)
Synonyms:
Tubulin inhibitor 16